C14H18NO11P — CID 89356812
5-O-(1-hydroxy-3-phosphonooxypropan-2-yl) 1-O-(4-nitrophenyl) pentanedioate (PubChem CID 89356812) has the molecular formula C14H18NO11P and a molecular weight of 407.27 g/mol. Its IUPAC name is 5-O-(1-hydroxy-3-phosphonooxypropan-2-yl) 1-O-(4-nitrophenyl) pentanedioate.
| Compound Name | 5-O-(1-hydroxy-3-phosphonooxypropan-2-yl) 1-O-(4-nitrophenyl) pentanedioate |
|---|---|
| PubChem CID | 89356812 |
| Molecular Formula | C14H18NO11P |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 5-O-(1-hydroxy-3-phosphonooxypropan-2-yl) 1-O-(4-nitrophenyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OC(CO)COP(=O)(O)O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18NO11P/c16-8-12(9-24-27(21,22)23)26-14(18)3-1-2-13(17)25-11-6-4-10(5-7-11)15(19)20/h4-7,12,16H,1-3,8-9H2,(H2,21,22,23) |
| InChIKey | KKAXBDIFVVXAOE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 182.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|