C20H29NO9 — CID 175151760
1,3-dihydroxypropan-2-yl 6-ethyl-4-(4-nitrophenoxy)carbonyloxyoctanoate (PubChem CID 175151760) has the molecular formula C20H29NO9 and a molecular weight of 427.45 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 6-ethyl-4-(4-nitrophenoxy)carbonyloxyoctanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 6-ethyl-4-(4-nitrophenoxy)carbonyloxyoctanoate |
|---|---|
| PubChem CID | 175151760 |
| Molecular Formula | C20H29NO9 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 6-ethyl-4-(4-nitrophenoxy)carbonyloxyoctanoate |
| SMILES | CCC(CC)CC(CCC(=O)OC(CO)CO)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H29NO9/c1-3-14(4-2)11-17(9-10-19(24)28-18(12-22)13-23)30-20(25)29-16-7-5-15(6-8-16)21(26)27/h5-8,14,17-18,22-23H,3-4,9-13H2,1-2H3 |
| InChIKey | WMTAXWBMONXQKC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|