About 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate
2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate (PubChem CID 155368708) has the molecular formula C35H59NO7
and a molecular weight of 605.86 g/mol. Its IUPAC name is 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate.
Molecular Properties
| Compound Name | 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate |
| PubChem CID | 155368708 |
| Molecular Formula | C35H59NO7 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.43 |
| IUPAC Name | 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCCCCCC(CCCCCC)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H59NO7/c1-4-7-10-16-21-30(20-9-6-3)29-41-34(37)24-19-15-13-12-14-18-23-32(22-17-11-8-5-2)42-35(38)43-33-27-25-31(26-28-33)36(39)40/h25-28,30,32H,4-24,29H2,1-3H3 |
| InChIKey | XTOMFNJKXBMLCA-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate?
The IUPAC name of 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate (CID 155368708) is 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate.
What is the SMILES notation for 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate?
The canonical SMILES for 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate is CCCCCCC(CCCC)COC(=O)CCCCCCCCC(CCCCCC)OC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate?
The InChIKey is XTOMFNJKXBMLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H59NO7/c1-4-7-10-16-21-30(20-9-6-3)29-41-34(37)24-19-15-13-12-14-18-23-32(22-17-11-8-5-2)42-35(38)43-33-27-25-31(26-28-33)36(39)40/h25-28,30,32H,4-24,29H2,1-3H3.
What are the key properties of 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate?
2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate has a molecular weight of 605.86 g/mol, XLogP of 10.89, 27 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyloctyl 10-(4-nitrophenoxy)carbonyloxyhexadecanoate is sourced from PubChem (CID 155368708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).