C30H49NO7 — CID 153372706
2-(2-butyloctyl)-5-(4-nitrophenoxy)carbonyloxyundecanoic acid (PubChem CID 153372706) has the molecular formula C30H49NO7 and a molecular weight of 535.72 g/mol. Its IUPAC name is 2-(2-butyloctyl)-5-(4-nitrophenoxy)carbonyloxyundecanoic acid.
| Compound Name | 2-(2-butyloctyl)-5-(4-nitrophenoxy)carbonyloxyundecanoic acid |
|---|---|
| PubChem CID | 153372706 |
| Molecular Formula | C30H49NO7 |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | 2-(2-butyloctyl)-5-(4-nitrophenoxy)carbonyloxyundecanoic acid |
| SMILES | CCCCCCC(CCCC)CC(CCC(CCCCCC)OC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C30H49NO7/c1-4-7-10-12-15-24(14-9-6-3)23-25(29(32)33)17-20-27(16-13-11-8-5-2)37-30(34)38-28-21-18-26(19-22-28)31(35)36/h18-19,21-22,24-25,27H,4-17,20,23H2,1-3H3,(H,32,33) |
| InChIKey | LBCSGWLWORIINB-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|