C52H87NO9 — CID 172607810
[9-heptadecan-9-yloxy-2-[(4-nitrophenoxy)carbonyloxymethyl]-9-oxononyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 172607810) has the molecular formula C52H87NO9 and a molecular weight of 870.27 g/mol. Its IUPAC name is [9-heptadecan-9-yloxy-2-[(4-nitrophenoxy)carbonyloxymethyl]-9-oxononyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [9-heptadecan-9-yloxy-2-[(4-nitrophenoxy)carbonyloxymethyl]-9-oxononyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 172607810 |
| Molecular Formula | C52H87NO9 |
| Molecular Weight | 870.27 g/mol |
| Exact Mass | 869.64 |
| IUPAC Name | [9-heptadecan-9-yloxy-2-[(4-nitrophenoxy)carbonyloxymethyl]-9-oxononyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C52H87NO9/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-27-33-38-50(54)59-44-46(45-60-52(56)62-49-42-40-47(41-43-49)53(57)58)35-30-28-29-34-39-51(55)61-48(36-31-25-14-11-8-5-2)37-32-26-15-12-9-6-3/h16-17,19-20,40-43,46,48H,4-15,18,21-39,44-45H2,1-3H3/b17-16-,20-19- |
| InChIKey | JPNWSZVNIFJMOF-LTXDKZCQSA-N |
| XLogP | 15.84 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.27 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|