C29H49N2O11P — CID 23395754
[3-decoxy-2-[5-(4-nitrophenoxy)-5-oxopentanoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 23395754) has the molecular formula C29H49N2O11P and a molecular weight of 632.69 g/mol. Its IUPAC name is [3-decoxy-2-[5-(4-nitrophenoxy)-5-oxopentanoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-decoxy-2-[5-(4-nitrophenoxy)-5-oxopentanoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 23395754 |
| Molecular Formula | C29H49N2O11P |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | [3-decoxy-2-[5-(4-nitrophenoxy)-5-oxopentanoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H49N2O11P/c1-5-6-7-8-9-10-11-12-21-38-23-27(24-40-43(36,37)39-22-20-31(2,3)4)42-29(33)15-13-14-28(32)41-26-18-16-25(17-19-26)30(34)35/h16-19,27H,5-15,20-24H2,1-4H3 |
| InChIKey | JURLNLWZHHLSTB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 163.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|