C28H48N2O12P+ — CID 59639273
2-[[3-decoxy-2-[3-(4-nitrophenoxy)carbonyloxypropanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59639273) has the molecular formula C28H48N2O12P+ and a molecular weight of 635.67 g/mol. Its IUPAC name is 2-[[3-decoxy-2-[3-(4-nitrophenoxy)carbonyloxypropanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-decoxy-2-[3-(4-nitrophenoxy)carbonyloxypropanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59639273 |
| Molecular Formula | C28H48N2O12P+ |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 2-[[3-decoxy-2-[3-(4-nitrophenoxy)carbonyloxypropanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H47N2O12P/c1-5-6-7-8-9-10-11-12-19-37-22-26(23-40-43(35,36)39-21-18-30(2,3)4)41-27(31)17-20-38-28(32)42-25-15-13-24(14-16-25)29(33)34/h13-16,26H,5-12,17-23H2,1-4H3/p+1 |
| InChIKey | ALLKRNZDCOTZMZ-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 169.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|