About 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium
2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium (PubChem CID 157067509) has the molecular formula C10H24NO2Y-
and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium.
Molecular Properties
| Compound Name | 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium |
| PubChem CID | 157067509 |
| Molecular Formula | C10H24NO2Y- |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium |
| SMILES | CCC(C)OC.C[N-]CC(C)OC.[Y] |
| InChI | InChI=1S/C5H12NO.C5H12O.Y/c1-5(7-3)4-6-2;1-4-5(2)6-3;/h5H,4H2,1-3H3;5H,4H2,1-3H3;/q-1;; |
| InChIKey | ZOIGLSXQZAPQJI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium?
The IUPAC name of 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium (CID 157067509) is 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium.
What is the SMILES notation for 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium?
The canonical SMILES for 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium is CCC(C)OC.C[N-]CC(C)OC.[Y].
What is the InChIKey of 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium?
The InChIKey is ZOIGLSXQZAPQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12NO.C5H12O.Y/c1-5(7-3)4-6-2;1-4-5(2)6-3;/h5H,4H2,1-3H3;5H,4H2,1-3H3;/q-1;;.
What are the key properties of 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium?
2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium has a molecular weight of 279.21 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybutane;2-methoxypropyl(methyl)azanide;yttrium is sourced from PubChem (CID 157067509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).