C6H13ClO2 — CID 13429724
(2R,3R)-3-chlorohexane-1,2-diol (PubChem CID 13429724) has the molecular formula C6H13ClO2 and a molecular weight of 152.62 g/mol. Its IUPAC name is (2R,3R)-3-chlorohexane-1,2-diol.
| Compound Name | (2R,3R)-3-chlorohexane-1,2-diol |
|---|---|
| PubChem CID | 13429724 |
| Molecular Formula | C6H13ClO2 |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (2R,3R)-3-chlorohexane-1,2-diol |
| SMILES | CCC[C@@H](Cl)[C@H](O)CO |
| InChI | InChI=1S/C6H13ClO2/c1-2-3-5(7)6(9)4-8/h5-6,8-9H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | ARBGJJZCHGOTTP-PHDIDXHHSA-N |
| XLogP | 0.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|