C7H14O3 — CID 126708294
2-(1,2-dihydroxyethyl)pentanal (PubChem CID 126708294) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)pentanal.
| Compound Name | 2-(1,2-dihydroxyethyl)pentanal |
|---|---|
| PubChem CID | 126708294 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)pentanal |
| SMILES | CCCC(C=O)C(O)CO |
| InChI | InChI=1S/C7H14O3/c1-2-3-6(4-8)7(10)5-9/h4,6-7,9-10H,2-3,5H2,1H3 |
| InChIKey | GYCPUPYNTJUHQM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|