C12H28O4 — CID 174384573
butane-1,1-diol;2-pentylpropane-1,3-diol (PubChem CID 174384573) has the molecular formula C12H28O4 and a molecular weight of 236.35 g/mol. Its IUPAC name is butane-1,1-diol;2-pentylpropane-1,3-diol.
| Compound Name | butane-1,1-diol;2-pentylpropane-1,3-diol |
|---|---|
| PubChem CID | 174384573 |
| Molecular Formula | C12H28O4 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | butane-1,1-diol;2-pentylpropane-1,3-diol |
| SMILES | CCCC(O)O.CCCCCC(CO)CO |
| InChI | InChI=1S/C8H18O2.C4H10O2/c1-2-3-4-5-8(6-9)7-10;1-2-3-4(5)6/h8-10H,2-7H2,1H3;4-6H,2-3H2,1H3 |
| InChIKey | PLWSUQJMGJRERD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|