C15H25NO — CID 10537732
11-amino-11-ethyltrideca-7,9-diyn-6-ol (PubChem CID 10537732) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 11-amino-11-ethyltrideca-7,9-diyn-6-ol.
| Compound Name | 11-amino-11-ethyltrideca-7,9-diyn-6-ol |
|---|---|
| PubChem CID | 10537732 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 11-amino-11-ethyltrideca-7,9-diyn-6-ol |
| SMILES | CCCCCC(O)C#CC#CC(N)(CC)CC |
| InChI | InChI=1S/C15H25NO/c1-4-7-8-11-14(17)12-9-10-13-15(16,5-2)6-3/h14,17H,4-8,11,16H2,1-3H3 |
| InChIKey | YVUCZVLSZZAWNR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|