C16H17BrO2 — CID 11141768
(11E,15E)-16-bromohexadeca-11,15-dien-3,5,13-triyne-1,2-diol (PubChem CID 11141768) has the molecular formula C16H17BrO2 and a molecular weight of 321.21 g/mol. Its IUPAC name is (11E,15E)-16-bromohexadeca-11,15-dien-3,5,13-triyne-1,2-diol.
| Compound Name | (11E,15E)-16-bromohexadeca-11,15-dien-3,5,13-triyne-1,2-diol |
|---|---|
| PubChem CID | 11141768 |
| Molecular Formula | C16H17BrO2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (11E,15E)-16-bromohexadeca-11,15-dien-3,5,13-triyne-1,2-diol |
| SMILES | OCC(O)C#CC#CCCCC/C=C/C#C/C=C/Br |
| InChI | InChI=1S/C16H17BrO2/c17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16(19)15-18/h4,6,12,14,16,18-19H,1-3,5,15H2/b6-4+,14-12+ |
| InChIKey | DJSFMRMJRHIIBW-LZUOLKHISA-N |
| XLogP | 2.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|