C24H31BrO2 — CID 71726777
ethyl (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate (PubChem CID 71726777) has the molecular formula C24H31BrO2 and a molecular weight of 431.41 g/mol. Its IUPAC name is ethyl (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate.
| Compound Name | ethyl (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate |
|---|---|
| PubChem CID | 71726777 |
| Molecular Formula | C24H31BrO2 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | ethyl (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate |
| SMILES | CCOC(=O)CCCCCCCC#CC#CCCCC/C=C/C#C/C=C/Br |
| InChI | InChI=1S/C24H31BrO2/c1-2-27-24(26)22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25/h13,15,21,23H,2,5,7,9-12,14,16,18,20,22H2,1H3/b15-13+,23-21+ |
| InChIKey | DRKSLRNHKQJHAR-IDQXUSCUSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|