C22H26BrKO2 — CID 71726776
potassium (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate (PubChem CID 71726776) has the molecular formula C22H26BrKO2 and a molecular weight of 441.45 g/mol. Its IUPAC name is potassium (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate.
| Compound Name | potassium (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate |
|---|---|
| PubChem CID | 71726776 |
| Molecular Formula | C22H26BrKO2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | potassium (17E,21E)-22-bromodocosa-17,21-dien-9,11,19-triynoate |
| SMILES | O=C([O-])CCCCCCCC#CC#CCCCC/C=C/C#C/C=C/Br.[K+] |
| InChI | InChI=1S/C22H27BrO2.K/c23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22(24)25;/h11,13,19,21H,3,5,7-10,12,14,16,18,20H2,(H,24,25);/q;+1/p-1/b13-11+,21-19+; |
| InChIKey | MGOYYBZASYSEKE-JHRYNHHSSA-M |
| XLogP | 1.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|