C18H21BrO2 — CID 102213703
(5Z,9E,17E)-18-bromooctadeca-5,9,17-trien-7,15-diynoic acid (PubChem CID 102213703) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is (5Z,9E,17E)-18-bromooctadeca-5,9,17-trien-7,15-diynoic acid.
| Compound Name | (5Z,9E,17E)-18-bromooctadeca-5,9,17-trien-7,15-diynoic acid |
|---|---|
| PubChem CID | 102213703 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (5Z,9E,17E)-18-bromooctadeca-5,9,17-trien-7,15-diynoic acid |
| SMILES | O=C(O)CCC/C=C\C#C/C=C/CCCCC#C/C=C/Br |
| InChI | InChI=1S/C18H21BrO2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h1-2,8,10,15,17H,3,5,7,9,12,14,16H2,(H,20,21)/b2-1+,10-8-,17-15+ |
| InChIKey | ZNKRCGJTYRACDZ-WJWGSRHGSA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|