C16H21BrO4 — CID 162968226
(9S,10S)-16-bromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid (PubChem CID 162968226) has the molecular formula C16H21BrO4 and a molecular weight of 357.24 g/mol. Its IUPAC name is (9S,10S)-16-bromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid.
| Compound Name | (9S,10S)-16-bromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid |
|---|---|
| PubChem CID | 162968226 |
| Molecular Formula | C16H21BrO4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (9S,10S)-16-bromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid |
| SMILES | O=C(O)CCCC#CC=C[C@H](O)[C@@H](O)CCC=CC=CBr |
| InChI | InChI=1S/C16H21BrO4/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h4-6,9-10,13-15,18-19H,3,7-8,11-12H2,(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | CMLHOHSLXZMHDU-GJZGRUSLSA-N |
| XLogP | 2.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|