C16H20Br2O4 — CID 162942965
(9R,10S)-14,16-dibromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid (PubChem CID 162942965) has the molecular formula C16H20Br2O4 and a molecular weight of 436.14 g/mol. Its IUPAC name is (9R,10S)-14,16-dibromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid.
| Compound Name | (9R,10S)-14,16-dibromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid |
|---|---|
| PubChem CID | 162942965 |
| Molecular Formula | C16H20Br2O4 |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | (9R,10S)-14,16-dibromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid |
| SMILES | O=C(O)CCCC#CC=C[C@@H](O)[C@@H](O)CCC=C(Br)C=CBr |
| InChI | InChI=1S/C16H20Br2O4/c17-12-11-13(18)7-6-9-15(20)14(19)8-4-2-1-3-5-10-16(21)22/h4,7-8,11-12,14-15,19-20H,3,5-6,9-10H2,(H,21,22)/t14-,15+/m1/s1 |
| InChIKey | OGYZPLNGMUVBNX-CABCVRRESA-N |
| XLogP | 3.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|