C23H31BrO3 — CID 71446693
18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid (PubChem CID 71446693) has the molecular formula C23H31BrO3 and a molecular weight of 435.40 g/mol. Its IUPAC name is 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid.
| Compound Name | 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid |
|---|---|
| PubChem CID | 71446693 |
| Molecular Formula | C23H31BrO3 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid |
| SMILES | CCCC=CC(Br)=CC(O)CCCCCCC=CC#CC#CCCC(=O)O |
| InChI | InChI=1S/C23H31BrO3/c1-2-3-14-17-21(24)20-22(25)18-15-12-10-8-6-4-5-7-9-11-13-16-19-23(26)27/h4-5,14,17,20,22,25H,2-3,6,8,10,12,15-16,18-19H2,1H3,(H,26,27) |
| InChIKey | OPRGCPSNLIJMIG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|