18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid

C23H31BrO3 — CID 71446693

IUPAC18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid
SMILESCCCC=CC(Br)=CC(O)CCCCCCC=CC#CC#CCCC(=O)O
InChIInChI=1S/C23H31BrO3/c1-2-3-14-17-21(24)20-22(25)18-15-12-10-8-6-4-5-7-9-11-13-16-19-23(26)27/h4-5,14,17,20,22,25H,2-3,6,8,10,12,15-16,18-19H2,1H3,(H,26,27)
InChIKeyOPRGCPSNLIJMIG-UHFFFAOYSA-N
MW435.40 g/mol
LogP5.75
Rot. Bonds13

About 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid

18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid (PubChem CID 71446693) has the molecular formula C23H31BrO3 and a molecular weight of 435.40 g/mol. Its IUPAC name is 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid.

Molecular Properties

Compound Name18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid
PubChem CID71446693
Molecular FormulaC23H31BrO3
Molecular Weight435.40 g/mol
Exact Mass434.15
IUPAC Name18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid
SMILESCCCC=CC(Br)=CC(O)CCCCCCC=CC#CC#CCCC(=O)O
InChIInChI=1S/C23H31BrO3/c1-2-3-14-17-21(24)20-22(25)18-15-12-10-8-6-4-5-7-9-11-13-16-19-23(26)27/h4-5,14,17,20,22,25H,2-3,6,8,10,12,15-16,18-19H2,1H3,(H,26,27)
InChIKeyOPRGCPSNLIJMIG-UHFFFAOYSA-N
XLogP5.75
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds13
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500435.40
LogP ≤ 55.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid?
The IUPAC name of 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid (CID 71446693) is 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid.
What is the SMILES notation for 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid?
The canonical SMILES for 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid is CCCC=CC(Br)=CC(O)CCCCCCC=CC#CC#CCCC(=O)O.
What is the InChIKey of 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid?
The InChIKey is OPRGCPSNLIJMIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31BrO3/c1-2-3-14-17-21(24)20-22(25)18-15-12-10-8-6-4-5-7-9-11-13-16-19-23(26)27/h4-5,14,17,20,22,25H,2-3,6,8,10,12,15-16,18-19H2,1H3,(H,26,27).
What are the key properties of 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid?
18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid has a molecular weight of 435.40 g/mol, XLogP of 5.75, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 18-bromo-16-hydroxytricosa-8,17,19-trien-4,6-diynoic acid is sourced from PubChem (CID 71446693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).