About dodec-5-en-7-yn-4-ol
dodec-5-en-7-yn-4-ol (PubChem CID 71331023) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is dodec-5-en-7-yn-4-ol.
Molecular Properties
| Compound Name | dodec-5-en-7-yn-4-ol |
| PubChem CID | 71331023 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | dodec-5-en-7-yn-4-ol |
| SMILES | CCCCC#CC=CC(O)CCC |
| InChI | InChI=1S/C12H20O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h9,11-13H,3-6,10H2,1-2H3 |
| InChIKey | LYBNLRLIWGUZBX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodec-5-en-7-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-5-en-7-yn-4-ol?
The IUPAC name of dodec-5-en-7-yn-4-ol (CID 71331023) is dodec-5-en-7-yn-4-ol.
What is the SMILES notation for dodec-5-en-7-yn-4-ol?
The canonical SMILES for dodec-5-en-7-yn-4-ol is CCCCC#CC=CC(O)CCC.
What is the InChIKey of dodec-5-en-7-yn-4-ol?
The InChIKey is LYBNLRLIWGUZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h9,11-13H,3-6,10H2,1-2H3.
What are the key properties of dodec-5-en-7-yn-4-ol?
dodec-5-en-7-yn-4-ol has a molecular weight of 180.29 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-5-en-7-yn-4-ol is sourced from PubChem (CID 71331023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).