About (Z)-dec-3-en-1-yn-5-ol
(Z)-dec-3-en-1-yn-5-ol (PubChem CID 146163105) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z)-dec-3-en-1-yn-5-ol.
Molecular Properties
| Compound Name | (Z)-dec-3-en-1-yn-5-ol |
| PubChem CID | 146163105 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (Z)-dec-3-en-1-yn-5-ol |
| SMILES | C#C/C=C\C(O)CCCCC |
| InChI | InChI=1S/C10H16O/c1-3-5-7-9-10(11)8-6-4-2/h2,6,8,10-11H,3,5,7,9H2,1H3/b8-6- |
| InChIKey | QTPYNFYCBVSETI-VURMDHGXSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-dec-3-en-1-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-dec-3-en-1-yn-5-ol?
The IUPAC name of (Z)-dec-3-en-1-yn-5-ol (CID 146163105) is (Z)-dec-3-en-1-yn-5-ol.
What is the SMILES notation for (Z)-dec-3-en-1-yn-5-ol?
The canonical SMILES for (Z)-dec-3-en-1-yn-5-ol is C#C/C=C\C(O)CCCCC.
What is the InChIKey of (Z)-dec-3-en-1-yn-5-ol?
The InChIKey is QTPYNFYCBVSETI-VURMDHGXSA-N. The full InChI is InChI=1S/C10H16O/c1-3-5-7-9-10(11)8-6-4-2/h2,6,8,10-11H,3,5,7,9H2,1H3/b8-6-.
What are the key properties of (Z)-dec-3-en-1-yn-5-ol?
(Z)-dec-3-en-1-yn-5-ol has a molecular weight of 152.24 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-dec-3-en-1-yn-5-ol is sourced from PubChem (CID 146163105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).