C30H48O — CID 10455056
(3Z,5R,15Z,27Z)-triaconta-3,15,27-trien-1,29-diyn-5-ol (PubChem CID 10455056) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (3Z,5R,15Z,27Z)-triaconta-3,15,27-trien-1,29-diyn-5-ol.
| Compound Name | (3Z,5R,15Z,27Z)-triaconta-3,15,27-trien-1,29-diyn-5-ol |
|---|---|
| PubChem CID | 10455056 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (3Z,5R,15Z,27Z)-triaconta-3,15,27-trien-1,29-diyn-5-ol |
| SMILES | C#C/C=C\CCCCCCCCCC/C=C\CCCCCCCCC[C@@H](O)/C=C\C#C |
| InChI | InChI=1S/C30H48O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-29-30(31)28-6-4-2/h1-2,5-7,18-19,28,30-31H,8-17,20-27,29H2/b7-5-,19-18-,28-6-/t30-/m0/s1 |
| InChIKey | NTBHIGRIXXRCLB-SXXRKNQRSA-N |
| XLogP | 8.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|