C23H26O2 — CID 74051672
tricos-20-en-3,5,10,12,22-pentayne-1,2-diol (PubChem CID 74051672) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is tricos-20-en-3,5,10,12,22-pentayne-1,2-diol.
| Compound Name | tricos-20-en-3,5,10,12,22-pentayne-1,2-diol |
|---|---|
| PubChem CID | 74051672 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tricos-20-en-3,5,10,12,22-pentayne-1,2-diol |
| SMILES | C#CC=CCCCCCCC#CC#CCCCC#CC#CC(O)CO |
| InChI | InChI=1S/C23H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25)22-24/h1,3-4,23-25H,5-10,15-17,22H2 |
| InChIKey | CXKNSXTVPUUYQM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|