C21H38OSi — CID 173483439
tert-butyl-dimethyl-[(6S,7R,8Z)-7-methyltetradeca-8,10-dien-12-yn-6-yl]oxysilane (PubChem CID 173483439) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(6S,7R,8Z)-7-methyltetradeca-8,10-dien-12-yn-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(6S,7R,8Z)-7-methyltetradeca-8,10-dien-12-yn-6-yl]oxysilane |
|---|---|
| PubChem CID | 173483439 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | tert-butyl-dimethyl-[(6S,7R,8Z)-7-methyltetradeca-8,10-dien-12-yn-6-yl]oxysilane |
| SMILES | CC#CC=C/C=C\[C@@H](C)[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38OSi/c1-9-11-13-14-16-17-19(3)20(18-15-12-10-2)22-23(7,8)21(4,5)6/h13-14,16-17,19-20H,10,12,15,18H2,1-8H3/b14-13?,17-16-/t19-,20+/m1/s1 |
| InChIKey | VXLRIZBCCNLLES-PPKXKJTFSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|