C25H52BO3Si- — CID 102316517
tert-butyl-dimethyl-[(E,5S)-1-(2,5,5-trimethyl-1,3-dioxa-2-boranuidacyclohex-2-yl)tridec-1-en-5-yl]oxysilane (PubChem CID 102316517) has the molecular formula C25H52BO3Si- and a molecular weight of 439.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,5S)-1-(2,5,5-trimethyl-1,3-dioxa-2-boranuidacyclohex-2-yl)tridec-1-en-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,5S)-1-(2,5,5-trimethyl-1,3-dioxa-2-boranuidacyclohex-2-yl)tridec-1-en-5-yl]oxysilane |
|---|---|
| PubChem CID | 102316517 |
| Molecular Formula | C25H52BO3Si- |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.38 |
| IUPAC Name | tert-butyl-dimethyl-[(E,5S)-1-(2,5,5-trimethyl-1,3-dioxa-2-boranuidacyclohex-2-yl)tridec-1-en-5-yl]oxysilane |
| SMILES | CCCCCCCC[C@@H](CC/C=C/[B-]1(C)OCC(C)(C)CO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52BO3Si/c1-10-11-12-13-14-15-18-23(29-30(8,9)24(2,3)4)19-16-17-20-26(7)27-21-25(5,6)22-28-26/h17,20,23H,10-16,18-19,21-22H2,1-9H3/q-1/b20-17+/t23-/m0/s1 |
| InChIKey | QXRXLUPXPZRQSV-JVIWHDFBSA-N |
| XLogP | 8.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|