C24H41BO4P2Si — CID 58785122
(3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 58785122) has the molecular formula C24H41BO4P2Si and a molecular weight of 494.43 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 58785122 |
| Molecular Formula | C24H41BO4P2Si |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCc1ccccc1)CC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OB(P)P |
| InChI | InChI=1S/C24H41BO4P2Si/c1-24(2,3)32(4,5)29-18(12-11-17-9-7-6-8-10-17)13-14-19-20-15-23(26)27-21(20)16-22(19)28-25(30)31/h6-10,18-22H,11-16,30-31H2,1-5H3/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | GYZDIMMGMFDZHU-AHJNKEMKSA-N |
| XLogP | 5.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|