C50H56O10 — CID 157176988
[(4R)-4-(3-hydroxy-5-phenylpentyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 157176988) has the molecular formula C50H56O10 and a molecular weight of 816.99 g/mol. Its IUPAC name is [(4R)-4-(3-hydroxy-5-phenylpentyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(4R)-4-(3-hydroxy-5-phenylpentyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 157176988 |
| Molecular Formula | C50H56O10 |
| Molecular Weight | 816.99 g/mol |
| Exact Mass | 816.39 |
| IUPAC Name | [(4R)-4-(3-hydroxy-5-phenylpentyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1CC2C(CC(OC(=O)c3ccccc3)[C@@H]2CCC(O)CCc2ccccc2)O1.O=C1CC2C(CC(OC(=O)c3ccccc3)[C@@H]2CCC(O)CCc2ccccc2)O1 |
| InChI | InChI=1S/2C25H28O5/c2*26-19(12-11-17-7-3-1-4-8-17)13-14-20-21-15-24(27)29-23(21)16-22(20)30-25(28)18-9-5-2-6-10-18/h2*1-10,19-23,26H,11-16H2/t2*19?,20-,21?,22?,23?/m11/s1 |
| InChIKey | AOCXOZQESZBPDZ-YUGKENQSSA-N |
| XLogP | 7.88 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.99 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|