C25H30O4 — CID 163701283
[(3aR,4R,5R,6aS)-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] benzoate (PubChem CID 163701283) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 163701283 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C(O[C@@H]1C[C@@H]2OCC[C@@H]2[C@H]1CC[C@@H](O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30O4/c26-20(12-11-18-7-3-1-4-8-18)13-14-21-22-15-16-28-23(22)17-24(21)29-25(27)19-9-5-2-6-10-19/h1-10,20-24,26H,11-17H2/t20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | KBFGTEUCCKCWRI-UDIRQSBCSA-N |
| XLogP | 4.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |