C25H30O5 — CID 121337013
[(3aR,4R,5R,6aS)-2-hydroxy-4-[(3S)-3-hydroxypentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 121337013) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-2-hydroxy-4-[(3S)-3-hydroxypentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-2-hydroxy-4-[(3S)-3-hydroxypentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 121337013 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(3aR,4R,5R,6aS)-2-hydroxy-4-[(3S)-3-hydroxypentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | CC[C@H](O)CC[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30O5/c1-2-19(26)12-13-20-21-14-24(27)29-23(21)15-22(20)30-25(28)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,19-24,26-27H,2,12-15H2,1H3/t19-,20+,21+,22+,23-,24?/m0/s1 |
| InChIKey | NUAXUKWJNMUILW-FAGNSDEYSA-N |
| XLogP | 4.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |