C18H26BO4P2 — CID 70958205
CID 70958205 (PubChem CID 70958205) has the molecular formula C18H26BO4P2 and a molecular weight of 379.16 g/mol.
| Compound Name | CID 70958205 |
|---|---|
| PubChem CID | 70958205 |
| Molecular Formula | C18H26BO4P2 |
| Molecular Weight | 379.16 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | — |
| SMILES | O=C1C[C@@H]2[C@@H](CC[C@@H](O)CCc3ccccc3)[C@H](OP[B]P)C[C@@H]2O1 |
| InChI | InChI=1S/C18H26BO4P2/c20-13(7-6-12-4-2-1-3-5-12)8-9-14-15-10-18(21)22-16(15)11-17(14)23-25-19-24/h1-5,13-17,20,25H,6-11,24H2/t13-,14+,15+,16-,17+/m0/s1 |
| InChIKey | PVMPHULZPKJXSO-JZAWBGDQSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|