C13H28BO4P3 — CID 90755799
(3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;tritium monohydride (PubChem CID 90755799) has the molecular formula C13H28BO4P3 and a molecular weight of 354.11 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;tritium monohydride.
| Compound Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;tritium monohydride |
|---|---|
| PubChem CID | 90755799 |
| Molecular Formula | C13H28BO4P3 |
| Molecular Weight | 354.11 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;tritium monohydride |
| SMILES | CCC[C@H](CC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OB(P)P)OP.[H][3H] |
| InChI | InChI=1S/C13H26BO4P3.H2/c1-2-3-8(18-21)4-5-9-10-6-13(15)16-11(10)7-12(9)17-14(19)20;/h8-12H,2-7,19-21H2,1H3;1H/t8-,9-,10-,11+,12-;/m1./s1/i;1+2 |
| InChIKey | QTTVCMYFPCRPTA-QFUBTTBESA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|