C17H31FO4PSi — CID 59963496
CID 59963496 (PubChem CID 59963496) has the molecular formula C17H31FO4PSi and a molecular weight of 377.49 g/mol.
| Compound Name | CID 59963496 |
|---|---|
| PubChem CID | 59963496 |
| Molecular Formula | C17H31FO4PSi |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | — |
| SMILES | CCCCC(F)C(CCC1C(OP)CC2OC(=O)CC21)O[Si](C)C |
| InChI | InChI=1S/C17H31FO4PSi/c1-4-5-6-13(18)14(22-24(2)3)8-7-11-12-9-17(19)20-15(12)10-16(11)21-23/h11-16H,4-10,23H2,1-3H3 |
| InChIKey | BDEGOTZOJGGEIL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|