C30H36O5 — CID 129198443
[(3aR,4R,5R,6aS)-4-[(E,3R)-3-(hydroxymethyl)-3-methyloct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 129198443) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(E,3R)-3-(hydroxymethyl)-3-methyloct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(E,3R)-3-(hydroxymethyl)-3-methyloct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 129198443 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(E,3R)-3-(hydroxymethyl)-3-methyloct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | CCCCC[C@](C)(/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1)CO |
| InChI | InChI=1S/C30H36O5/c1-3-4-8-16-30(2,20-31)17-15-24-25-18-28(32)34-27(25)19-26(24)35-29(33)23-13-11-22(12-14-23)21-9-6-5-7-10-21/h5-7,9-15,17,24-27,31H,3-4,8,16,18-20H2,1-2H3/b17-15+/t24-,25-,26-,27+,30-/m1/s1 |
| InChIKey | UWKAYPOLWYSTEX-VROJMRIOSA-N |
| XLogP | 5.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|