C31H26O5S — CID 67000519
[(3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 67000519) has the molecular formula C31H26O5S and a molecular weight of 510.61 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 67000519 |
| Molecular Formula | C31H26O5S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | O=C1C[C@@H]2[C@@H](C=C[C@@H](O)c3cc4ccccc4s3)[C@H](OC(=O)c3ccc(-c4ccccc4)cc3)C[C@@H]2O1 |
| InChI | InChI=1S/C31H26O5S/c32-25(29-16-22-8-4-5-9-28(22)37-29)15-14-23-24-17-30(33)35-27(24)18-26(23)36-31(34)21-12-10-20(11-13-21)19-6-2-1-3-7-19/h1-16,23-27,32H,17-18H2/t23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | RJZBEYWEIHMXKP-ACFIUOAZSA-N |
| XLogP | 6.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|