C32H34O4 — CID 121354457
[(1R,2R,3aS,6aS)-5-hydroxy-1-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] 4-phenylbenzoate (PubChem CID 121354457) has the molecular formula C32H34O4 and a molecular weight of 482.62 g/mol. Its IUPAC name is [(1R,2R,3aS,6aS)-5-hydroxy-1-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] 4-phenylbenzoate.
| Compound Name | [(1R,2R,3aS,6aS)-5-hydroxy-1-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 121354457 |
| Molecular Formula | C32H34O4 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [(1R,2R,3aS,6aS)-5-hydroxy-1-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] 4-phenylbenzoate |
| SMILES | O=C(O[C@@H]1C[C@@H]2CC(O)C[C@@H]2[C@H]1/C=C/[C@@H](O)CCc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34O4/c33-27(16-11-22-7-3-1-4-8-22)17-18-29-30-21-28(34)19-26(30)20-31(29)36-32(35)25-14-12-24(13-15-25)23-9-5-2-6-10-23/h1-10,12-15,17-18,26-31,33-34H,11,16,19-21H2/b18-17+/t26-,27-,28?,29+,30-,31+/m0/s1 |
| InChIKey | JQULCTUIOOEZAK-IOJDPJPLSA-N |
| XLogP | 5.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|