C25H35ClO4 — CID 22951516
3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-[(E)-hept-2-enyl]-4-methylcyclopentan-1-ol (PubChem CID 22951516) has the molecular formula C25H35ClO4 and a molecular weight of 435.00 g/mol. Its IUPAC name is 3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-[(E)-hept-2-enyl]-4-methylcyclopentan-1-ol.
| Compound Name | 3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-[(E)-hept-2-enyl]-4-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 22951516 |
| Molecular Formula | C25H35ClO4 |
| Molecular Weight | 435.00 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-[(E)-hept-2-enyl]-4-methylcyclopentan-1-ol |
| SMILES | CCCC/C=C/CC1C(O)CC(C)C1/C=C/C1(COc2cccc(Cl)c2)OCCO1 |
| InChI | InChI=1S/C25H35ClO4/c1-3-4-5-6-7-11-23-22(19(2)16-24(23)27)12-13-25(29-14-15-30-25)18-28-21-10-8-9-20(26)17-21/h6-10,12-13,17,19,22-24,27H,3-5,11,14-16,18H2,1-2H3/b7-6+,13-12+ |
| InChIKey | FYJQPFXNUUCEME-GYIPPJPDSA-N |
| XLogP | 5.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|