C24H33FO2 — CID 22951141
3-[(E)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-4-fluoro-2-[(E)-hept-2-enyl]cyclopentan-1-ol (PubChem CID 22951141) has the molecular formula C24H33FO2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 3-[(E)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-4-fluoro-2-[(E)-hept-2-enyl]cyclopentan-1-ol.
| Compound Name | 3-[(E)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-4-fluoro-2-[(E)-hept-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 22951141 |
| Molecular Formula | C24H33FO2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 3-[(E)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-4-fluoro-2-[(E)-hept-2-enyl]cyclopentan-1-ol |
| SMILES | CCCC/C=C/CC1C(O)CC(F)C1/C=C/C(O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H33FO2/c1-2-3-4-5-6-11-21-20(22(25)16-24(21)27)12-13-23(26)19-14-17-9-7-8-10-18(17)15-19/h5-10,12-13,19-24,26-27H,2-4,11,14-16H2,1H3/b6-5+,13-12+ |
| InChIKey | VEZAOZFANPGAAN-LHELVOSYSA-N |
| XLogP | 4.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|