C24H32FO2P — CID 59878802
(E)-1-(2,3-dihydro-1H-inden-2-yl)-3-[(1R,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]prop-2-en-1-one (PubChem CID 59878802) has the molecular formula C24H32FO2P and a molecular weight of 402.49 g/mol. Its IUPAC name is (E)-1-(2,3-dihydro-1H-inden-2-yl)-3-[(1R,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydro-1H-inden-2-yl)-3-[(1R,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59878802 |
| Molecular Formula | C24H32FO2P |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (E)-1-(2,3-dihydro-1H-inden-2-yl)-3-[(1R,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]prop-2-en-1-one |
| SMILES | CCCC/C=C\C[C@H]1C(OP)CC(F)[C@@H]1/C=C/C(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H32FO2P/c1-2-3-4-5-6-11-21-20(22(25)16-24(21)27-28)12-13-23(26)19-14-17-9-7-8-10-18(17)15-19/h5-10,12-13,19-22,24H,2-4,11,14-16,28H2,1H3/b6-5-,13-12+/t20-,21-,22?,24?/m1/s1 |
| InChIKey | QTDUXEVPVFEPAM-LOPQMOSSSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|