C20H34FO3P — CID 59963451
3-(4-fluoro-3-oxooctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-one (PubChem CID 59963451) has the molecular formula C20H34FO3P and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-(4-fluoro-3-oxooctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-one.
| Compound Name | 3-(4-fluoro-3-oxooctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-one |
|---|---|
| PubChem CID | 59963451 |
| Molecular Formula | C20H34FO3P |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 3-(4-fluoro-3-oxooctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-one |
| SMILES | CCCC/C=C\CC1C(=O)CC(OP)C1CCC(=O)C(F)CCCC |
| InChI | InChI=1S/C20H34FO3P/c1-3-5-7-8-9-10-15-16(20(24-25)14-19(15)23)12-13-18(22)17(21)11-6-4-2/h8-9,15-17,20H,3-7,10-14,25H2,1-2H3/b9-8- |
| InChIKey | IFQMXQMEVGIYMT-HJWRWDBZSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|