C23H39O6P — CID 59963395
methyl (E)-7-[(2R)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-2-enoate (PubChem CID 59963395) has the molecular formula C23H39O6P and a molecular weight of 442.53 g/mol. Its IUPAC name is methyl (E)-7-[(2R)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-2-enoate.
| Compound Name | methyl (E)-7-[(2R)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 59963395 |
| Molecular Formula | C23H39O6P |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | methyl (E)-7-[(2R)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-2-enoate |
| SMILES | CCCCCC1(CC[C@H]2C(OP)CC(=O)C2CCCC/C=C/C(=O)OC)OCCO1 |
| InChI | InChI=1S/C23H39O6P/c1-3-4-9-13-23(27-15-16-28-23)14-12-19-18(20(24)17-21(19)29-30)10-7-5-6-8-11-22(25)26-2/h8,11,18-19,21H,3-7,9-10,12-17,30H2,1-2H3/b11-8+/t18?,19-,21?/m1/s1 |
| InChIKey | YWHHKMOZGBPGPE-NYYUZUQHSA-N |
| XLogP | 4.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|