C31H46BrFO3Si — CID 58715002
[(1S,2R,3R,4S)-2-[(Z)-6-bromohex-2-enyl]-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yl)prop-1-enyl]-4-fluorocyclopentyl] acetate (PubChem CID 58715002) has the molecular formula C31H46BrFO3Si and a molecular weight of 593.69 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-2-[(Z)-6-bromohex-2-enyl]-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yl)prop-1-enyl]-4-fluorocyclopentyl] acetate.
| Compound Name | [(1S,2R,3R,4S)-2-[(Z)-6-bromohex-2-enyl]-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yl)prop-1-enyl]-4-fluorocyclopentyl] acetate |
|---|---|
| PubChem CID | 58715002 |
| Molecular Formula | C31H46BrFO3Si |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | [(1S,2R,3R,4S)-2-[(Z)-6-bromohex-2-enyl]-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yl)prop-1-enyl]-4-fluorocyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](F)[C@H](/C=C/C(O[Si](C)(C)C(C)(C)C)C2Cc3ccccc3C2)[C@H]1C/C=C\CCCBr |
| InChI | InChI=1S/C31H46BrFO3Si/c1-22(34)35-30-21-28(33)26(27(30)15-9-7-8-12-18-32)16-17-29(36-37(5,6)31(2,3)4)25-19-23-13-10-11-14-24(23)20-25/h7,9-11,13-14,16-17,25-30H,8,12,15,18-21H2,1-6H3/b9-7-,17-16+/t26-,27-,28+,29?,30+/m1/s1 |
| InChIKey | KZNCJXHATXAYNC-JDZNXXABSA-N |
| XLogP | 8.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|