C21H40NO6P3S — CID 20637370
(E)-7-[3,5-bis(phosphanyloxy)-2-[(E)-3-phosphanyloxyoct-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide (PubChem CID 20637370) has the molecular formula C21H40NO6P3S and a molecular weight of 527.54 g/mol. Its IUPAC name is (E)-7-[3,5-bis(phosphanyloxy)-2-[(E)-3-phosphanyloxyoct-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide.
| Compound Name | (E)-7-[3,5-bis(phosphanyloxy)-2-[(E)-3-phosphanyloxyoct-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide |
|---|---|
| PubChem CID | 20637370 |
| Molecular Formula | C21H40NO6P3S |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | (E)-7-[3,5-bis(phosphanyloxy)-2-[(E)-3-phosphanyloxyoct-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide |
| SMILES | CCCCCC(/C=C/C1C(OP)CC(OP)C1C/C=C/CCCC(=O)NS(C)(=O)=O)OP |
| InChI | InChI=1S/C21H40NO6P3S/c1-3-4-7-10-16(26-29)13-14-18-17(19(27-30)15-20(18)28-31)11-8-5-6-9-12-21(23)22-32(2,24)25/h5,8,13-14,16-20H,3-4,6-7,9-12,15,29-31H2,1-2H3,(H,22,23)/b8-5+,14-13+ |
| InChIKey | LDTWHGNNKWCOAR-SEYMNPNRSA-N |
| XLogP | 4.48 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|