C31H53O8P — CID 10929963
[(1S,2R,3R,4R)-4-acetyloxy-3-[(E,3S)-3-acetyloxyoct-1-enyl]-2-[(Z)-6-[butyl(ethoxy)phosphoryl]hex-2-enyl]cyclopentyl] acetate (PubChem CID 10929963) has the molecular formula C31H53O8P and a molecular weight of 584.73 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-4-acetyloxy-3-[(E,3S)-3-acetyloxyoct-1-enyl]-2-[(Z)-6-[butyl(ethoxy)phosphoryl]hex-2-enyl]cyclopentyl] acetate.
| Compound Name | [(1S,2R,3R,4R)-4-acetyloxy-3-[(E,3S)-3-acetyloxyoct-1-enyl]-2-[(Z)-6-[butyl(ethoxy)phosphoryl]hex-2-enyl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 10929963 |
| Molecular Formula | C31H53O8P |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | [(1S,2R,3R,4R)-4-acetyloxy-3-[(E,3S)-3-acetyloxyoct-1-enyl]-2-[(Z)-6-[butyl(ethoxy)phosphoryl]hex-2-enyl]cyclopentyl] acetate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCP(=O)(CCCC)OCC)[C@@H](OC(C)=O)C[C@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C31H53O8P/c1-7-10-14-17-27(37-24(4)32)19-20-29-28(30(38-25(5)33)23-31(29)39-26(6)34)18-15-12-13-16-22-40(35,36-9-3)21-11-8-2/h12,15,19-20,27-31H,7-11,13-14,16-18,21-23H2,1-6H3/b15-12-,20-19+/t27-,28+,29+,30-,31+,40?/m0/s1 |
| InChIKey | DQRPUXLQHCKTFD-QCKOZEGRSA-N |
| XLogP | 7.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|