C20H28N6O2 — CID 10475120
(5S)-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]imidazolidin-2-one (PubChem CID 10475120) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (5S)-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]imidazolidin-2-one.
| Compound Name | (5S)-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 10475120 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (5S)-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]imidazolidin-2-one |
| SMILES | O=C1NC[C@H](/C=C/C(O)Cc2ccccc2)N1CCCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C20H28N6O2/c27-18(14-16-8-4-3-5-9-16)12-11-17-15-21-20(28)26(17)13-7-2-1-6-10-19-22-24-25-23-19/h3-5,8-9,11-12,17-18,27H,1-2,6-7,10,13-15H2,(H,21,28)(H,22,23,24,25)/b12-11+/t17-,18?/m0/s1 |
| InChIKey | YISYDNODXRGUOZ-ZOVTXPBASA-N |
| XLogP | 1.86 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|