C22H26N2O5 — CID 162280974
2-[4-[(2R)-2-[4-(2-cyanophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enoxy]acetic acid (PubChem CID 162280974) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[4-(2-cyanophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[4-(2-cyanophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 162280974 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[4-[(2R)-2-[4-(2-cyanophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enoxy]acetic acid |
| SMILES | N#Cc1ccccc1CC(O)C=C[C@H]1CCCC(=O)N1CC=CCOCC(=O)O |
| InChI | InChI=1S/C22H26N2O5/c23-15-18-7-2-1-6-17(18)14-20(25)11-10-19-8-5-9-21(26)24(19)12-3-4-13-29-16-22(27)28/h1-4,6-7,10-11,19-20,25H,5,8-9,12-14,16H2,(H,27,28)/t19-,20?/m1/s1 |
| InChIKey | DBVHJLBEZOWFAH-FIWHBWSRSA-N |
| XLogP | 2.06 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|