C23H29NO4 — CID 90451595
methyl 7-[(2R)-2-[(E,3S)-3-hydroxy-5-phenylpent-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 90451595) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[(E,3S)-3-hydroxy-5-phenylpent-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[(E,3S)-3-hydroxy-5-phenylpent-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 90451595 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | methyl 7-[(2R)-2-[(E,3S)-3-hydroxy-5-phenylpent-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCCN1C(=O)CC[C@@H]1/C=C/[C@H](O)C#Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO4/c1-28-23(27)11-7-2-3-8-18-24-20(14-17-22(24)26)13-16-21(25)15-12-19-9-5-4-6-10-19/h4-6,9-10,13,16,20-21,25H,2-3,7-8,11,14,17-18H2,1H3/b16-13+/t20-,21+/m0/s1 |
| InChIKey | FQZRFQJEZXKHFT-IJQABYDPSA-N |
| XLogP | 3.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|