C24H33NO4S — CID 155027443
methyl 5-[3-[(2R)-2-[(E,4S,5S)-4-hydroxy-5-methyldec-2-en-7-yn-2-yl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate (PubChem CID 155027443) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is methyl 5-[3-[(2R)-2-[(E,4S,5S)-4-hydroxy-5-methyldec-2-en-7-yn-2-yl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(2R)-2-[(E,4S,5S)-4-hydroxy-5-methyldec-2-en-7-yn-2-yl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 155027443 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | methyl 5-[3-[(2R)-2-[(E,4S,5S)-4-hydroxy-5-methyldec-2-en-7-yn-2-yl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCC#CC[C@H](C)[C@H](O)/C=C(\C)[C@H]1CCC(=O)N1CCCc1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C24H33NO4S/c1-5-6-7-9-17(2)21(26)16-18(3)20-12-14-23(27)25(20)15-8-10-19-11-13-22(30-19)24(28)29-4/h11,13,16-17,20-21,26H,5,8-10,12,14-15H2,1-4H3/b18-16+/t17-,20+,21+/m0/s1 |
| InChIKey | LRUNQJUSMLMCJZ-DBPAOHQDSA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|