C22H29NO4S — CID 86296571
methyl 5-[3-[(2R)-2-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate (PubChem CID 86296571) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is methyl 5-[3-[(2R)-2-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(2R)-2-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86296571 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl 5-[3-[(2R)-2-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate |
| SMILES | CC#CC[C@@H](C)[C@H](O)/C=C/[C@H]1CCC(=O)N1CCCc1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C22H29NO4S/c1-4-5-7-16(2)19(24)12-9-17-10-14-21(25)23(17)15-6-8-18-11-13-20(28-18)22(26)27-3/h9,11-13,16-17,19,24H,6-8,10,14-15H2,1-3H3/b12-9+/t16-,17+,19-/m1/s1 |
| InChIKey | PXCRHKVONMQIAW-KSHJQNSNSA-N |
| XLogP | 3.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|