About 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid
5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 59582105) has the molecular formula C22H27NO3S
and a molecular weight of 385.53 g/mol. Its IUPAC name is 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid |
| PubChem CID | 59582105 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(C)cc(CCN2C(=O)CCC2CCCc2ccc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C22H27NO3S/c1-15-12-16(2)14-17(13-15)10-11-23-18(6-9-21(23)24)4-3-5-19-7-8-20(27-19)22(25)26/h7-8,12-14,18H,3-6,9-11H2,1-2H3,(H,25,26) |
| InChIKey | LFEUCSHPSIGKIA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid (CID 59582105) is 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid is Cc1cc(C)cc(CCN2C(=O)CCC2CCCc2ccc(C(=O)O)s2)c1.
What is the InChIKey of 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid?
The InChIKey is LFEUCSHPSIGKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3S/c1-15-12-16(2)14-17(13-15)10-11-23-18(6-9-21(23)24)4-3-5-19-7-8-20(27-19)22(25)26/h7-8,12-14,18H,3-6,9-11H2,1-2H3,(H,25,26).
What are the key properties of 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid?
5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid has a molecular weight of 385.53 g/mol, XLogP of 4.62, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[1-[2-(3,5-dimethylphenyl)ethyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 59582105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).