C19H27F2NO3 — CID 144778345
7-[3,3-difluoro-5-[(E)-oct-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 144778345) has the molecular formula C19H27F2NO3 and a molecular weight of 355.43 g/mol. Its IUPAC name is 7-[3,3-difluoro-5-[(E)-oct-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[3,3-difluoro-5-[(E)-oct-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 144778345 |
| Molecular Formula | C19H27F2NO3 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 7-[3,3-difluoro-5-[(E)-oct-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CC#CCCC/C=C/C1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C19H27F2NO3/c1-2-3-4-5-6-9-12-16-15-19(20,21)18(25)22(16)14-11-8-7-10-13-17(23)24/h9,12,16H,4-8,10-11,13-15H2,1H3,(H,23,24)/b12-9+ |
| InChIKey | TVKOJQSMXOJJRN-FMIVXFBMSA-N |
| XLogP | 4.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|